C11H18N4O2 — CID 113321215
5-[(2-hydroxy-3-methoxypropyl)-methylamino]pyridine-2-carboximidamide (PubChem CID 113321215) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 5-[(2-hydroxy-3-methoxypropyl)-methylamino]pyridine-2-carboximidamide.
| Compound Name | 5-[(2-hydroxy-3-methoxypropyl)-methylamino]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 113321215 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 5-[(2-hydroxy-3-methoxypropyl)-methylamino]pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(C)CC(O)COC)cn1 |
| InChI | InChI=1S/C11H18N4O2/c1-15(6-9(16)7-17-2)8-3-4-10(11(12)13)14-5-8/h3-5,9,16H,6-7H2,1-2H3,(H3,12,13) |
| InChIKey | WXAASURTAOKHGP-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|