About 1-cyano-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide
1-cyano-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide (PubChem CID 113322121) has the molecular formula C12H17F3N2O
and a molecular weight of 262.27 g/mol. Its IUPAC name is 1-cyano-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide.
Molecular Properties
| Compound Name | 1-cyano-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide |
| PubChem CID | 113322121 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-cyano-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide |
| SMILES | N#CC1(C(=O)NCCCCC(F)(F)F)CCCC1 |
| InChI | InChI=1S/C12H17F3N2O/c13-12(14,15)7-3-4-8-17-10(18)11(9-16)5-1-2-6-11/h1-8H2,(H,17,18) |
| InChIKey | KBKYTPWXHBGXEJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-cyano-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide?
The IUPAC name of 1-cyano-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide (CID 113322121) is 1-cyano-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide.
What is the SMILES notation for 1-cyano-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide?
The canonical SMILES for 1-cyano-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide is N#CC1(C(=O)NCCCCC(F)(F)F)CCCC1.
What is the InChIKey of 1-cyano-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide?
The InChIKey is KBKYTPWXHBGXEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F3N2O/c13-12(14,15)7-3-4-8-17-10(18)11(9-16)5-1-2-6-11/h1-8H2,(H,17,18).
What are the key properties of 1-cyano-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide?
1-cyano-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide has a molecular weight of 262.27 g/mol, XLogP of 2.92, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-N-(5,5,5-trifluoropentyl)cyclopentane-1-carboxamide is sourced from PubChem (CID 113322121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).