C13H9F3N2O — CID 113323609
N-[(2,5-difluorophenyl)methyl]-6-fluoropyridine-2-carboxamide (PubChem CID 113323609) has the molecular formula C13H9F3N2O and a molecular weight of 266.22 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-6-fluoropyridine-2-carboxamide.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-6-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 113323609 |
| Molecular Formula | C13H9F3N2O |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-6-fluoropyridine-2-carboxamide |
| SMILES | O=C(NCc1cc(F)ccc1F)c1cccc(F)n1 |
| InChI | InChI=1S/C13H9F3N2O/c14-9-4-5-10(15)8(6-9)7-17-13(19)11-2-1-3-12(16)18-11/h1-6H,7H2,(H,17,19) |
| InChIKey | WOJKKCYPPNLTEN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|