About 2-amino-5-[(3,4-dimethylcyclohexyl)amino]benzonitrile
2-amino-5-[(3,4-dimethylcyclohexyl)amino]benzonitrile (PubChem CID 113324010) has the molecular formula C15H21N3
and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-amino-5-[(3,4-dimethylcyclohexyl)amino]benzonitrile.
Molecular Properties
| Compound Name | 2-amino-5-[(3,4-dimethylcyclohexyl)amino]benzonitrile |
| PubChem CID | 113324010 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 2-amino-5-[(3,4-dimethylcyclohexyl)amino]benzonitrile |
| SMILES | CC1CCC(Nc2ccc(N)c(C#N)c2)CC1C |
| InChI | InChI=1S/C15H21N3/c1-10-3-4-13(7-11(10)2)18-14-5-6-15(17)12(8-14)9-16/h5-6,8,10-11,13,18H,3-4,7,17H2,1-2H3 |
| InChIKey | SLYREXJOYPKYOU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-[(3,4-dimethylcyclohexyl)amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-[(3,4-dimethylcyclohexyl)amino]benzonitrile?
The IUPAC name of 2-amino-5-[(3,4-dimethylcyclohexyl)amino]benzonitrile (CID 113324010) is 2-amino-5-[(3,4-dimethylcyclohexyl)amino]benzonitrile.
What is the SMILES notation for 2-amino-5-[(3,4-dimethylcyclohexyl)amino]benzonitrile?
The canonical SMILES for 2-amino-5-[(3,4-dimethylcyclohexyl)amino]benzonitrile is CC1CCC(Nc2ccc(N)c(C#N)c2)CC1C.
What is the InChIKey of 2-amino-5-[(3,4-dimethylcyclohexyl)amino]benzonitrile?
The InChIKey is SLYREXJOYPKYOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3/c1-10-3-4-13(7-11(10)2)18-14-5-6-15(17)12(8-14)9-16/h5-6,8,10-11,13,18H,3-4,7,17H2,1-2H3.
What are the key properties of 2-amino-5-[(3,4-dimethylcyclohexyl)amino]benzonitrile?
2-amino-5-[(3,4-dimethylcyclohexyl)amino]benzonitrile has a molecular weight of 243.35 g/mol, XLogP of 3.38, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-[(3,4-dimethylcyclohexyl)amino]benzonitrile is sourced from PubChem (CID 113324010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).