C15H19N3 — CID 113324602
N,5-dimethyl-6-(2,4,6-trimethylphenyl)pyrimidin-4-amine (PubChem CID 113324602) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is N,5-dimethyl-6-(2,4,6-trimethylphenyl)pyrimidin-4-amine.
| Compound Name | N,5-dimethyl-6-(2,4,6-trimethylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 113324602 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N,5-dimethyl-6-(2,4,6-trimethylphenyl)pyrimidin-4-amine |
| SMILES | CNc1ncnc(-c2c(C)cc(C)cc2C)c1C |
| InChI | InChI=1S/C15H19N3/c1-9-6-10(2)13(11(3)7-9)14-12(4)15(16-5)18-8-17-14/h6-8H,1-5H3,(H,16,17,18) |
| InChIKey | HOSZGNVABKBHCQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |