About 3-diazopiperidin-2-one
3-diazopiperidin-2-one (PubChem CID 11332462) has the molecular formula C5H7N3O
and a molecular weight of 125.13 g/mol. Its IUPAC name is 3-diazopiperidin-2-one.
Molecular Properties
| Compound Name | 3-diazopiperidin-2-one |
| PubChem CID | 11332462 |
| Molecular Formula | C5H7N3O |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | 3-diazopiperidin-2-one |
| SMILES | [N-]=[N+]=C1CCCNC1=O |
| InChI | InChI=1S/C5H7N3O/c6-8-4-2-1-3-7-5(4)9/h1-3H2,(H,7,9) |
| InChIKey | SHPIODBBHQGMOA-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-diazopiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diazopiperidin-2-one?
The IUPAC name of 3-diazopiperidin-2-one (CID 11332462) is 3-diazopiperidin-2-one.
What is the SMILES notation for 3-diazopiperidin-2-one?
The canonical SMILES for 3-diazopiperidin-2-one is [N-]=[N+]=C1CCCNC1=O.
What is the InChIKey of 3-diazopiperidin-2-one?
The InChIKey is SHPIODBBHQGMOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O/c6-8-4-2-1-3-7-5(4)9/h1-3H2,(H,7,9).
What are the key properties of 3-diazopiperidin-2-one?
3-diazopiperidin-2-one has a molecular weight of 125.13 g/mol, XLogP of -0.43, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diazopiperidin-2-one is sourced from PubChem (CID 11332462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).