C13H16F2N2O — CID 113325242
2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-4,6-difluoroaniline (PubChem CID 113325242) has the molecular formula C13H16F2N2O and a molecular weight of 254.28 g/mol. Its IUPAC name is 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-4,6-difluoroaniline.
| Compound Name | 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-4,6-difluoroaniline |
|---|---|
| PubChem CID | 113325242 |
| Molecular Formula | C13H16F2N2O |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-4,6-difluoroaniline |
| SMILES | Nc1c(F)cc(F)cc1N1CCOC2CCCC21 |
| InChI | InChI=1S/C13H16F2N2O/c14-8-6-9(15)13(16)11(7-8)17-4-5-18-12-3-1-2-10(12)17/h6-7,10,12H,1-5,16H2 |
| InChIKey | ABFZXYFDLFZPMT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|