About 1-methoxy-1,3-dihydro-2-benzofuran
1-methoxy-1,3-dihydro-2-benzofuran (PubChem CID 11332556) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is 1-methoxy-1,3-dihydro-2-benzofuran.
Molecular Properties
| Compound Name | 1-methoxy-1,3-dihydro-2-benzofuran |
| PubChem CID | 11332556 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 1-methoxy-1,3-dihydro-2-benzofuran |
| SMILES | COC1OCc2ccccc21 |
| InChI | InChI=1S/C9H10O2/c1-10-9-8-5-3-2-4-7(8)6-11-9/h2-5,9H,6H2,1H3 |
| InChIKey | HHFOTZJVYJNYJC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methoxy-1,3-dihydro-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-1,3-dihydro-2-benzofuran?
The IUPAC name of 1-methoxy-1,3-dihydro-2-benzofuran (CID 11332556) is 1-methoxy-1,3-dihydro-2-benzofuran.
What is the SMILES notation for 1-methoxy-1,3-dihydro-2-benzofuran?
The canonical SMILES for 1-methoxy-1,3-dihydro-2-benzofuran is COC1OCc2ccccc21.
What is the InChIKey of 1-methoxy-1,3-dihydro-2-benzofuran?
The InChIKey is HHFOTZJVYJNYJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-10-9-8-5-3-2-4-7(8)6-11-9/h2-5,9H,6H2,1H3.
What are the key properties of 1-methoxy-1,3-dihydro-2-benzofuran?
1-methoxy-1,3-dihydro-2-benzofuran has a molecular weight of 150.18 g/mol, XLogP of 1.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-1,3-dihydro-2-benzofuran is sourced from PubChem (CID 11332556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).