About 1-methylcyclohexa-2,5-diene-1-carbonyl chloride
1-methylcyclohexa-2,5-diene-1-carbonyl chloride (PubChem CID 11332598) has the molecular formula C8H9ClO
and a molecular weight of 156.61 g/mol. Its IUPAC name is 1-methylcyclohexa-2,5-diene-1-carbonyl chloride.
Molecular Properties
| Compound Name | 1-methylcyclohexa-2,5-diene-1-carbonyl chloride |
| PubChem CID | 11332598 |
| Molecular Formula | C8H9ClO |
| Molecular Weight | 156.61 g/mol |
| Exact Mass | 156.03 |
| IUPAC Name | 1-methylcyclohexa-2,5-diene-1-carbonyl chloride |
| SMILES | CC1(C(=O)Cl)C=CCC=C1 |
| InChI | InChI=1S/C8H9ClO/c1-8(7(9)10)5-3-2-4-6-8/h3-6H,2H2,1H3 |
| InChIKey | IFURTPINWQYMPC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.61 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methylcyclohexa-2,5-diene-1-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylcyclohexa-2,5-diene-1-carbonyl chloride?
The IUPAC name of 1-methylcyclohexa-2,5-diene-1-carbonyl chloride (CID 11332598) is 1-methylcyclohexa-2,5-diene-1-carbonyl chloride.
What is the SMILES notation for 1-methylcyclohexa-2,5-diene-1-carbonyl chloride?
The canonical SMILES for 1-methylcyclohexa-2,5-diene-1-carbonyl chloride is CC1(C(=O)Cl)C=CCC=C1.
What is the InChIKey of 1-methylcyclohexa-2,5-diene-1-carbonyl chloride?
The InChIKey is IFURTPINWQYMPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClO/c1-8(7(9)10)5-3-2-4-6-8/h3-6H,2H2,1H3.
What are the key properties of 1-methylcyclohexa-2,5-diene-1-carbonyl chloride?
1-methylcyclohexa-2,5-diene-1-carbonyl chloride has a molecular weight of 156.61 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylcyclohexa-2,5-diene-1-carbonyl chloride is sourced from PubChem (CID 11332598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).