About (4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(2-methyloxolan-3-yl)methanone
(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(2-methyloxolan-3-yl)methanone (PubChem CID 113326150) has the molecular formula C13H13ClN2O2
and a molecular weight of 264.71 g/mol. Its IUPAC name is (4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(2-methyloxolan-3-yl)methanone.
Molecular Properties
| Compound Name | (4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(2-methyloxolan-3-yl)methanone |
| PubChem CID | 113326150 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | (4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(2-methyloxolan-3-yl)methanone |
| SMILES | CC1OCCC1C(=O)c1c[nH]c2nccc(Cl)c12 |
| InChI | InChI=1S/C13H13ClN2O2/c1-7-8(3-5-18-7)12(17)9-6-16-13-11(9)10(14)2-4-15-13/h2,4,6-8H,3,5H2,1H3,(H,15,16) |
| InChIKey | CQPMDQUPKAVNPA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(2-methyloxolan-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(2-methyloxolan-3-yl)methanone?
The IUPAC name of (4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(2-methyloxolan-3-yl)methanone (CID 113326150) is (4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(2-methyloxolan-3-yl)methanone.
What is the SMILES notation for (4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(2-methyloxolan-3-yl)methanone?
The canonical SMILES for (4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(2-methyloxolan-3-yl)methanone is CC1OCCC1C(=O)c1c[nH]c2nccc(Cl)c12.
What is the InChIKey of (4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(2-methyloxolan-3-yl)methanone?
The InChIKey is CQPMDQUPKAVNPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClN2O2/c1-7-8(3-5-18-7)12(17)9-6-16-13-11(9)10(14)2-4-15-13/h2,4,6-8H,3,5H2,1H3,(H,15,16).
What are the key properties of (4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(2-methyloxolan-3-yl)methanone?
(4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(2-methyloxolan-3-yl)methanone has a molecular weight of 264.71 g/mol, XLogP of 2.82, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-(2-methyloxolan-3-yl)methanone is sourced from PubChem (CID 113326150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).