C10H10BrF4NO — CID 113326202
3-bromo-5-fluoro-2-(4,4,4-trifluorobutoxy)aniline (PubChem CID 113326202) has the molecular formula C10H10BrF4NO and a molecular weight of 316.09 g/mol. Its IUPAC name is 3-bromo-5-fluoro-2-(4,4,4-trifluorobutoxy)aniline.
| Compound Name | 3-bromo-5-fluoro-2-(4,4,4-trifluorobutoxy)aniline |
|---|---|
| PubChem CID | 113326202 |
| Molecular Formula | C10H10BrF4NO |
| Molecular Weight | 316.09 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 3-bromo-5-fluoro-2-(4,4,4-trifluorobutoxy)aniline |
| SMILES | Nc1cc(F)cc(Br)c1OCCCC(F)(F)F |
| InChI | InChI=1S/C10H10BrF4NO/c11-7-4-6(12)5-8(16)9(7)17-3-1-2-10(13,14)15/h4-5H,1-3,16H2 |
| InChIKey | YKDLVDIKTWPVGG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.09 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|