C10H9ClF3N3S — CID 113326361
5-chloro-N-(4,4,4-trifluorobutyl)-2,1,3-benzothiadiazol-4-amine (PubChem CID 113326361) has the molecular formula C10H9ClF3N3S and a molecular weight of 295.72 g/mol. Its IUPAC name is 5-chloro-N-(4,4,4-trifluorobutyl)-2,1,3-benzothiadiazol-4-amine.
| Compound Name | 5-chloro-N-(4,4,4-trifluorobutyl)-2,1,3-benzothiadiazol-4-amine |
|---|---|
| PubChem CID | 113326361 |
| Molecular Formula | C10H9ClF3N3S |
| Molecular Weight | 295.72 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 5-chloro-N-(4,4,4-trifluorobutyl)-2,1,3-benzothiadiazol-4-amine |
| SMILES | FC(F)(F)CCCNc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C10H9ClF3N3S/c11-6-2-3-7-9(17-18-16-7)8(6)15-5-1-4-10(12,13)14/h2-3,15H,1,4-5H2 |
| InChIKey | MOMGXDIKZCDSKW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.72 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|