C9H13OSi — CID 11332679
4-dimethylsiloxy-1,6-heptadiyne (PubChem CID 11332679) has the molecular formula C9H13OSi and a molecular weight of 165.29 g/mol.
| Compound Name | 4-dimethylsiloxy-1,6-heptadiyne |
|---|---|
| PubChem CID | 11332679 |
| Molecular Formula | C9H13OSi |
| Molecular Weight | 165.29 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | — |
| SMILES | C#CCC(CC#C)O[Si](C)C |
| InChI | InChI=1S/C9H13OSi/c1-5-7-9(8-6-2)10-11(3)4/h1-2,9H,7-8H2,3-4H3 |
| InChIKey | CDBLJEGAFDFBMC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|