About 1-[2-oxo-2-(4,4,4-trifluorobutylamino)ethyl]cyclopentane-1-carboxylic acid
1-[2-oxo-2-(4,4,4-trifluorobutylamino)ethyl]cyclopentane-1-carboxylic acid (PubChem CID 113326810) has the molecular formula C12H18F3NO3
and a molecular weight of 281.27 g/mol. Its IUPAC name is 1-[2-oxo-2-(4,4,4-trifluorobutylamino)ethyl]cyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2-oxo-2-(4,4,4-trifluorobutylamino)ethyl]cyclopentane-1-carboxylic acid |
| PubChem CID | 113326810 |
| Molecular Formula | C12H18F3NO3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-[2-oxo-2-(4,4,4-trifluorobutylamino)ethyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(CC1(C(=O)O)CCCC1)NCCCC(F)(F)F |
| InChI | InChI=1S/C12H18F3NO3/c13-12(14,15)6-3-7-16-9(17)8-11(10(18)19)4-1-2-5-11/h1-8H2,(H,16,17)(H,18,19) |
| InChIKey | AUWHEMOABRKBMG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-oxo-2-(4,4,4-trifluorobutylamino)ethyl]cyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-oxo-2-(4,4,4-trifluorobutylamino)ethyl]cyclopentane-1-carboxylic acid?
The IUPAC name of 1-[2-oxo-2-(4,4,4-trifluorobutylamino)ethyl]cyclopentane-1-carboxylic acid (CID 113326810) is 1-[2-oxo-2-(4,4,4-trifluorobutylamino)ethyl]cyclopentane-1-carboxylic acid.
What is the SMILES notation for 1-[2-oxo-2-(4,4,4-trifluorobutylamino)ethyl]cyclopentane-1-carboxylic acid?
The canonical SMILES for 1-[2-oxo-2-(4,4,4-trifluorobutylamino)ethyl]cyclopentane-1-carboxylic acid is O=C(CC1(C(=O)O)CCCC1)NCCCC(F)(F)F.
What is the InChIKey of 1-[2-oxo-2-(4,4,4-trifluorobutylamino)ethyl]cyclopentane-1-carboxylic acid?
The InChIKey is AUWHEMOABRKBMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F3NO3/c13-12(14,15)6-3-7-16-9(17)8-11(10(18)19)4-1-2-5-11/h1-8H2,(H,16,17)(H,18,19).
What are the key properties of 1-[2-oxo-2-(4,4,4-trifluorobutylamino)ethyl]cyclopentane-1-carboxylic acid?
1-[2-oxo-2-(4,4,4-trifluorobutylamino)ethyl]cyclopentane-1-carboxylic acid has a molecular weight of 281.27 g/mol, XLogP of 2.48, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-oxo-2-(4,4,4-trifluorobutylamino)ethyl]cyclopentane-1-carboxylic acid is sourced from PubChem (CID 113326810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).