C8H10F3N3O4S — CID 113326819
5-(4,4,4-trifluorobutylsulfamoyl)-1H-pyrazole-4-carboxylic acid (PubChem CID 113326819) has the molecular formula C8H10F3N3O4S and a molecular weight of 301.25 g/mol. Its IUPAC name is 5-(4,4,4-trifluorobutylsulfamoyl)-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-(4,4,4-trifluorobutylsulfamoyl)-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 113326819 |
| Molecular Formula | C8H10F3N3O4S |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 5-(4,4,4-trifluorobutylsulfamoyl)-1H-pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn[nH]c1S(=O)(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C8H10F3N3O4S/c9-8(10,11)2-1-3-13-19(17,18)6-5(7(15)16)4-12-14-6/h4,13H,1-3H2,(H,12,14)(H,15,16) |
| InChIKey | QBEIEEBLTBYSQZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|