About 3-[4-[(4,4,4-trifluorobutylamino)methyl]triazol-1-yl]propan-1-ol
3-[4-[(4,4,4-trifluorobutylamino)methyl]triazol-1-yl]propan-1-ol (PubChem CID 113326915) has the molecular formula C10H17F3N4O
and a molecular weight of 266.27 g/mol. Its IUPAC name is 3-[4-[(4,4,4-trifluorobutylamino)methyl]triazol-1-yl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[4-[(4,4,4-trifluorobutylamino)methyl]triazol-1-yl]propan-1-ol |
| PubChem CID | 113326915 |
| Molecular Formula | C10H17F3N4O |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 3-[4-[(4,4,4-trifluorobutylamino)methyl]triazol-1-yl]propan-1-ol |
| SMILES | OCCCn1cc(CNCCCC(F)(F)F)nn1 |
| InChI | InChI=1S/C10H17F3N4O/c11-10(12,13)3-1-4-14-7-9-8-17(16-15-9)5-2-6-18/h8,14,18H,1-7H2 |
| InChIKey | QSWCWDBAZROOBA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[(4,4,4-trifluorobutylamino)methyl]triazol-1-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(4,4,4-trifluorobutylamino)methyl]triazol-1-yl]propan-1-ol?
The IUPAC name of 3-[4-[(4,4,4-trifluorobutylamino)methyl]triazol-1-yl]propan-1-ol (CID 113326915) is 3-[4-[(4,4,4-trifluorobutylamino)methyl]triazol-1-yl]propan-1-ol.
What is the SMILES notation for 3-[4-[(4,4,4-trifluorobutylamino)methyl]triazol-1-yl]propan-1-ol?
The canonical SMILES for 3-[4-[(4,4,4-trifluorobutylamino)methyl]triazol-1-yl]propan-1-ol is OCCCn1cc(CNCCCC(F)(F)F)nn1.
What is the InChIKey of 3-[4-[(4,4,4-trifluorobutylamino)methyl]triazol-1-yl]propan-1-ol?
The InChIKey is QSWCWDBAZROOBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3N4O/c11-10(12,13)3-1-4-14-7-9-8-17(16-15-9)5-2-6-18/h8,14,18H,1-7H2.
What are the key properties of 3-[4-[(4,4,4-trifluorobutylamino)methyl]triazol-1-yl]propan-1-ol?
3-[4-[(4,4,4-trifluorobutylamino)methyl]triazol-1-yl]propan-1-ol has a molecular weight of 266.27 g/mol, XLogP of 1.09, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(4,4,4-trifluorobutylamino)methyl]triazol-1-yl]propan-1-ol is sourced from PubChem (CID 113326915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).