C14H26F3N — CID 113326984
5-methyl-2-propan-2-yl-N-(4,4,4-trifluorobutyl)cyclohexan-1-amine (PubChem CID 113326984) has the molecular formula C14H26F3N and a molecular weight of 265.36 g/mol. Its IUPAC name is 5-methyl-2-propan-2-yl-N-(4,4,4-trifluorobutyl)cyclohexan-1-amine.
| Compound Name | 5-methyl-2-propan-2-yl-N-(4,4,4-trifluorobutyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 113326984 |
| Molecular Formula | C14H26F3N |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 5-methyl-2-propan-2-yl-N-(4,4,4-trifluorobutyl)cyclohexan-1-amine |
| SMILES | CC1CCC(C(C)C)C(NCCCC(F)(F)F)C1 |
| InChI | InChI=1S/C14H26F3N/c1-10(2)12-6-5-11(3)9-13(12)18-8-4-7-14(15,16)17/h10-13,18H,4-9H2,1-3H3 |
| InChIKey | MXKWIFGVOIBKFO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|