C13H24F3NO — CID 113327066
5,5,5-trifluoro-1-(oxan-3-yl)-N-propylpentan-1-amine (PubChem CID 113327066) has the molecular formula C13H24F3NO and a molecular weight of 267.33 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-(oxan-3-yl)-N-propylpentan-1-amine.
| Compound Name | 5,5,5-trifluoro-1-(oxan-3-yl)-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 113327066 |
| Molecular Formula | C13H24F3NO |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 5,5,5-trifluoro-1-(oxan-3-yl)-N-propylpentan-1-amine |
| SMILES | CCCNC(CCCC(F)(F)F)C1CCCOC1 |
| InChI | InChI=1S/C13H24F3NO/c1-2-8-17-12(6-3-7-13(14,15)16)11-5-4-9-18-10-11/h11-12,17H,2-10H2,1H3 |
| InChIKey | HFHYFGRYHRRLMN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |