C12H19F3N2S — CID 113327082
N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-5,5,5-trifluoropentan-1-amine (PubChem CID 113327082) has the molecular formula C12H19F3N2S and a molecular weight of 280.36 g/mol. Its IUPAC name is N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-5,5,5-trifluoropentan-1-amine.
| Compound Name | N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 113327082 |
| Molecular Formula | C12H19F3N2S |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-5,5,5-trifluoropentan-1-amine |
| SMILES | Cc1nc(C(C)NCCCCC(F)(F)F)c(C)s1 |
| InChI | InChI=1S/C12H19F3N2S/c1-8(11-9(2)18-10(3)17-11)16-7-5-4-6-12(13,14)15/h8,16H,4-7H2,1-3H3 |
| InChIKey | WWQUTLGUODDUTK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|