C12H23F3N2O — CID 113327114
7,7,7-trifluoro-2-methyl-2-morpholin-4-ylheptan-3-amine (PubChem CID 113327114) has the molecular formula C12H23F3N2O and a molecular weight of 268.32 g/mol. Its IUPAC name is 7,7,7-trifluoro-2-methyl-2-morpholin-4-ylheptan-3-amine.
| Compound Name | 7,7,7-trifluoro-2-methyl-2-morpholin-4-ylheptan-3-amine |
|---|---|
| PubChem CID | 113327114 |
| Molecular Formula | C12H23F3N2O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 7,7,7-trifluoro-2-methyl-2-morpholin-4-ylheptan-3-amine |
| SMILES | CC(C)(C(N)CCCC(F)(F)F)N1CCOCC1 |
| InChI | InChI=1S/C12H23F3N2O/c1-11(2,17-6-8-18-9-7-17)10(16)4-3-5-12(13,14)15/h10H,3-9,16H2,1-2H3 |
| InChIKey | TUIILCPIDGUHKY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |