About 2-cyclopropyl-2-(4,4,4-trifluorobutyl)azepane
2-cyclopropyl-2-(4,4,4-trifluorobutyl)azepane (PubChem CID 113327133) has the molecular formula C13H22F3N
and a molecular weight of 249.32 g/mol. Its IUPAC name is 2-cyclopropyl-2-(4,4,4-trifluorobutyl)azepane.
Molecular Properties
| Compound Name | 2-cyclopropyl-2-(4,4,4-trifluorobutyl)azepane |
| PubChem CID | 113327133 |
| Molecular Formula | C13H22F3N |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-cyclopropyl-2-(4,4,4-trifluorobutyl)azepane |
| SMILES | FC(F)(F)CCCC1(C2CC2)CCCCCN1 |
| InChI | InChI=1S/C13H22F3N/c14-13(15,16)9-4-8-12(11-5-6-11)7-2-1-3-10-17-12/h11,17H,1-10H2 |
| InChIKey | NTQWDCBRIFDXSQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclopropyl-2-(4,4,4-trifluorobutyl)azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-2-(4,4,4-trifluorobutyl)azepane?
The IUPAC name of 2-cyclopropyl-2-(4,4,4-trifluorobutyl)azepane (CID 113327133) is 2-cyclopropyl-2-(4,4,4-trifluorobutyl)azepane.
What is the SMILES notation for 2-cyclopropyl-2-(4,4,4-trifluorobutyl)azepane?
The canonical SMILES for 2-cyclopropyl-2-(4,4,4-trifluorobutyl)azepane is FC(F)(F)CCCC1(C2CC2)CCCCCN1.
What is the InChIKey of 2-cyclopropyl-2-(4,4,4-trifluorobutyl)azepane?
The InChIKey is NTQWDCBRIFDXSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F3N/c14-13(15,16)9-4-8-12(11-5-6-11)7-2-1-3-10-17-12/h11,17H,1-10H2.
What are the key properties of 2-cyclopropyl-2-(4,4,4-trifluorobutyl)azepane?
2-cyclopropyl-2-(4,4,4-trifluorobutyl)azepane has a molecular weight of 249.32 g/mol, XLogP of 4.03, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-2-(4,4,4-trifluorobutyl)azepane is sourced from PubChem (CID 113327133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).