C11H21F3N2O — CID 113327482
2-amino-3-methyl-N-(5,5,5-trifluoropentyl)pentanamide (PubChem CID 113327482) has the molecular formula C11H21F3N2O and a molecular weight of 254.30 g/mol. Its IUPAC name is 2-amino-3-methyl-N-(5,5,5-trifluoropentyl)pentanamide.
| Compound Name | 2-amino-3-methyl-N-(5,5,5-trifluoropentyl)pentanamide |
|---|---|
| PubChem CID | 113327482 |
| Molecular Formula | C11H21F3N2O |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2-amino-3-methyl-N-(5,5,5-trifluoropentyl)pentanamide |
| SMILES | CCC(C)C(N)C(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O/c1-3-8(2)9(15)10(17)16-7-5-4-6-11(12,13)14/h8-9H,3-7,15H2,1-2H3,(H,16,17) |
| InChIKey | ZXQVOPXQPOSMJA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|