C10H17F3N2O2 — CID 113327522
3-amino-N-(5,5,5-trifluoropentyl)oxolane-3-carboxamide (PubChem CID 113327522) has the molecular formula C10H17F3N2O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is 3-amino-N-(5,5,5-trifluoropentyl)oxolane-3-carboxamide.
| Compound Name | 3-amino-N-(5,5,5-trifluoropentyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 113327522 |
| Molecular Formula | C10H17F3N2O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3-amino-N-(5,5,5-trifluoropentyl)oxolane-3-carboxamide |
| SMILES | NC1(C(=O)NCCCCC(F)(F)F)CCOC1 |
| InChI | InChI=1S/C10H17F3N2O2/c11-10(12,13)3-1-2-5-15-8(16)9(14)4-6-17-7-9/h1-7,14H2,(H,15,16) |
| InChIKey | HTWMYRWIQRLFJE-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|