About 3-methyl-1,1-dipropylthiourea
3-methyl-1,1-dipropylthiourea (PubChem CID 11332770) has the molecular formula C8H18N2S
and a molecular weight of 174.31 g/mol. Its IUPAC name is 3-methyl-1,1-dipropylthiourea.
Molecular Properties
| Compound Name | 3-methyl-1,1-dipropylthiourea |
| PubChem CID | 11332770 |
| Molecular Formula | C8H18N2S |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 3-methyl-1,1-dipropylthiourea |
| SMILES | CCCN(CCC)C(=S)NC |
| InChI | InChI=1S/C8H18N2S/c1-4-6-10(7-5-2)8(11)9-3/h4-7H2,1-3H3,(H,9,11) |
| InChIKey | IBQTWOXEJABQFD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1,1-dipropylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,1-dipropylthiourea?
The IUPAC name of 3-methyl-1,1-dipropylthiourea (CID 11332770) is 3-methyl-1,1-dipropylthiourea.
What is the SMILES notation for 3-methyl-1,1-dipropylthiourea?
The canonical SMILES for 3-methyl-1,1-dipropylthiourea is CCCN(CCC)C(=S)NC.
What is the InChIKey of 3-methyl-1,1-dipropylthiourea?
The InChIKey is IBQTWOXEJABQFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2S/c1-4-6-10(7-5-2)8(11)9-3/h4-7H2,1-3H3,(H,9,11).
What are the key properties of 3-methyl-1,1-dipropylthiourea?
3-methyl-1,1-dipropylthiourea has a molecular weight of 174.31 g/mol, XLogP of 1.61, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,1-dipropylthiourea is sourced from PubChem (CID 11332770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).