C10H13F3N2O4 — CID 113327780
(E)-4-oxo-4-(5,5,5-trifluoropentylcarbamoylamino)but-2-enoic acid (PubChem CID 113327780) has the molecular formula C10H13F3N2O4 and a molecular weight of 282.22 g/mol. Its IUPAC name is (E)-4-oxo-4-(5,5,5-trifluoropentylcarbamoylamino)but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-(5,5,5-trifluoropentylcarbamoylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 113327780 |
| Molecular Formula | C10H13F3N2O4 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | (E)-4-oxo-4-(5,5,5-trifluoropentylcarbamoylamino)but-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)NC(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O4/c11-10(12,13)5-1-2-6-14-9(19)15-7(16)3-4-8(17)18/h3-4H,1-2,5-6H2,(H,17,18)(H2,14,15,16,19)/b4-3+ |
| InChIKey | NNFLPYWKJIAYRW-ONEGZZNKSA-N |
| XLogP | 1.19 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|