C10H10BrF3N4 — CID 113327789
8-bromo-N-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 113327789) has the molecular formula C10H10BrF3N4 and a molecular weight of 323.12 g/mol. Its IUPAC name is 8-bromo-N-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-bromo-N-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 113327789 |
| Molecular Formula | C10H10BrF3N4 |
| Molecular Weight | 323.12 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 8-bromo-N-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | FC(F)(F)CCCNc1nc2c(Br)cccn2n1 |
| InChI | InChI=1S/C10H10BrF3N4/c11-7-3-1-6-18-8(7)16-9(17-18)15-5-2-4-10(12,13)14/h1,3,6H,2,4-5H2,(H,15,17) |
| InChIKey | GCPIENSFHNEOBP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.12 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|