C11H10F4N2S — CID 113327851
6-fluoro-3-(4,4,4-trifluorobutyl)-1H-benzimidazole-2-thione (PubChem CID 113327851) has the molecular formula C11H10F4N2S and a molecular weight of 278.27 g/mol. Its IUPAC name is 6-fluoro-3-(4,4,4-trifluorobutyl)-1H-benzimidazole-2-thione.
| Compound Name | 6-fluoro-3-(4,4,4-trifluorobutyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 113327851 |
| Molecular Formula | C11H10F4N2S |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 6-fluoro-3-(4,4,4-trifluorobutyl)-1H-benzimidazole-2-thione |
| SMILES | Fc1ccc2c(c1)[nH]c(=S)n2CCCC(F)(F)F |
| InChI | InChI=1S/C11H10F4N2S/c12-7-2-3-9-8(6-7)16-10(18)17(9)5-1-4-11(13,14)15/h2-3,6H,1,4-5H2,(H,16,18) |
| InChIKey | BKCMKGNWESVNGX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|