C11H19F3N2O3 — CID 113327926
3-[ethyl(4,4,4-trifluorobutylcarbamoyl)amino]butanoic acid (PubChem CID 113327926) has the molecular formula C11H19F3N2O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is 3-[ethyl(4,4,4-trifluorobutylcarbamoyl)amino]butanoic acid.
| Compound Name | 3-[ethyl(4,4,4-trifluorobutylcarbamoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 113327926 |
| Molecular Formula | C11H19F3N2O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-[ethyl(4,4,4-trifluorobutylcarbamoyl)amino]butanoic acid |
| SMILES | CCN(C(=O)NCCCC(F)(F)F)C(C)CC(=O)O |
| InChI | InChI=1S/C11H19F3N2O3/c1-3-16(8(2)7-9(17)18)10(19)15-6-4-5-11(12,13)14/h8H,3-7H2,1-2H3,(H,15,19)(H,17,18) |
| InChIKey | KIDRIHMGBHQVLL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|