C11H15ClF3N3 — CID 113327992
6-chloro-5-propyl-N-(4,4,4-trifluorobutyl)pyrimidin-4-amine (PubChem CID 113327992) has the molecular formula C11H15ClF3N3 and a molecular weight of 281.71 g/mol. Its IUPAC name is 6-chloro-5-propyl-N-(4,4,4-trifluorobutyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-5-propyl-N-(4,4,4-trifluorobutyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 113327992 |
| Molecular Formula | C11H15ClF3N3 |
| Molecular Weight | 281.71 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 6-chloro-5-propyl-N-(4,4,4-trifluorobutyl)pyrimidin-4-amine |
| SMILES | CCCc1c(Cl)ncnc1NCCCC(F)(F)F |
| InChI | InChI=1S/C11H15ClF3N3/c1-2-4-8-9(12)17-7-18-10(8)16-6-3-5-11(13,14)15/h7H,2-6H2,1H3,(H,16,17,18) |
| InChIKey | MTUHUIQWRFPYPE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.71 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|