C10H15F3N4 — CID 113328191
1-(5,5,5-trifluoropentyl)-4,5,6,7-tetrahydrotriazolo[4,5-c]pyridine (PubChem CID 113328191) has the molecular formula C10H15F3N4 and a molecular weight of 248.25 g/mol. Its IUPAC name is 1-(5,5,5-trifluoropentyl)-4,5,6,7-tetrahydrotriazolo[4,5-c]pyridine.
| Compound Name | 1-(5,5,5-trifluoropentyl)-4,5,6,7-tetrahydrotriazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 113328191 |
| Molecular Formula | C10H15F3N4 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-(5,5,5-trifluoropentyl)-4,5,6,7-tetrahydrotriazolo[4,5-c]pyridine |
| SMILES | FC(F)(F)CCCCn1nnc2c1CCNC2 |
| InChI | InChI=1S/C10H15F3N4/c11-10(12,13)4-1-2-6-17-9-3-5-14-7-8(9)15-16-17/h14H,1-7H2 |
| InChIKey | NJUJJHYEOKESIX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|