C10H10F3N3O2 — CID 113328202
2,4-dioxo-1-(5,5,5-trifluoropentyl)pyrimidine-5-carbonitrile (PubChem CID 113328202) has the molecular formula C10H10F3N3O2 and a molecular weight of 261.20 g/mol. Its IUPAC name is 2,4-dioxo-1-(5,5,5-trifluoropentyl)pyrimidine-5-carbonitrile.
| Compound Name | 2,4-dioxo-1-(5,5,5-trifluoropentyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 113328202 |
| Molecular Formula | C10H10F3N3O2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2,4-dioxo-1-(5,5,5-trifluoropentyl)pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cn(CCCCC(F)(F)F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H10F3N3O2/c11-10(12,13)3-1-2-4-16-6-7(5-14)8(17)15-9(16)18/h6H,1-4H2,(H,15,17,18) |
| InChIKey | BOMRDBFPDNHSCS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|