C10H8N4 — CID 11332868
1,3,12-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaen-13-amine (PubChem CID 11332868) has the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. Its IUPAC name is 1,3,12-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaen-13-amine.
| Compound Name | 1,3,12-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaen-13-amine |
|---|---|
| PubChem CID | 11332868 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1,3,12-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaen-13-amine |
| SMILES | Nc1nccc2cc3cccnc3n12 |
| InChI | InChI=1S/C10H8N4/c11-10-13-5-3-8-6-7-2-1-4-12-9(7)14(8)10/h1-6H,(H2,11,13) |
| InChIKey | NAWSGAXZHRACMN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |