C17H23N — CID 113329802
2,2-dimethyl-N-(2-methylbut-3-yn-2-yl)-3,4-dihydro-1H-naphthalen-1-amine (PubChem CID 113329802) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is 2,2-dimethyl-N-(2-methylbut-3-yn-2-yl)-3,4-dihydro-1H-naphthalen-1-amine.
| Compound Name | 2,2-dimethyl-N-(2-methylbut-3-yn-2-yl)-3,4-dihydro-1H-naphthalen-1-amine |
|---|---|
| PubChem CID | 113329802 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 2,2-dimethyl-N-(2-methylbut-3-yn-2-yl)-3,4-dihydro-1H-naphthalen-1-amine |
| SMILES | C#CC(C)(C)NC1c2ccccc2CCC1(C)C |
| InChI | InChI=1S/C17H23N/c1-6-17(4,5)18-15-14-10-8-7-9-13(14)11-12-16(15,2)3/h1,7-10,15,18H,11-12H2,2-5H3 |
| InChIKey | BGXWIIIBHCQEKM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|