C12H16O2 — CID 11332995
6-(prop-2-enoxymethyl)-1,3,3a,4-tetrahydro-2-benzofuran (PubChem CID 11332995) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 6-(prop-2-enoxymethyl)-1,3,3a,4-tetrahydro-2-benzofuran.
| Compound Name | 6-(prop-2-enoxymethyl)-1,3,3a,4-tetrahydro-2-benzofuran |
|---|---|
| PubChem CID | 11332995 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 6-(prop-2-enoxymethyl)-1,3,3a,4-tetrahydro-2-benzofuran |
| SMILES | C=CCOCC1=CCC2COCC2=C1 |
| InChI | InChI=1S/C12H16O2/c1-2-5-13-7-10-3-4-11-8-14-9-12(11)6-10/h2-3,6,11H,1,4-5,7-9H2 |
| InChIKey | BGSZUYJMSRQNRA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|