About 1-cyclohexylprop-2-enyl methyl carbonate
1-cyclohexylprop-2-enyl methyl carbonate (PubChem CID 11333087) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is 1-cyclohexylprop-2-enyl methyl carbonate.
Molecular Properties
| Compound Name | 1-cyclohexylprop-2-enyl methyl carbonate |
| PubChem CID | 11333087 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 1-cyclohexylprop-2-enyl methyl carbonate |
| SMILES | C=CC(OC(=O)OC)C1CCCCC1 |
| InChI | InChI=1S/C11H18O3/c1-3-10(14-11(12)13-2)9-7-5-4-6-8-9/h3,9-10H,1,4-8H2,2H3 |
| InChIKey | NYDLESXUXXPUKM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexylprop-2-enyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylprop-2-enyl methyl carbonate?
The IUPAC name of 1-cyclohexylprop-2-enyl methyl carbonate (CID 11333087) is 1-cyclohexylprop-2-enyl methyl carbonate.
What is the SMILES notation for 1-cyclohexylprop-2-enyl methyl carbonate?
The canonical SMILES for 1-cyclohexylprop-2-enyl methyl carbonate is C=CC(OC(=O)OC)C1CCCCC1.
What is the InChIKey of 1-cyclohexylprop-2-enyl methyl carbonate?
The InChIKey is NYDLESXUXXPUKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3/c1-3-10(14-11(12)13-2)9-7-5-4-6-8-9/h3,9-10H,1,4-8H2,2H3.
What are the key properties of 1-cyclohexylprop-2-enyl methyl carbonate?
1-cyclohexylprop-2-enyl methyl carbonate has a molecular weight of 198.26 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylprop-2-enyl methyl carbonate is sourced from PubChem (CID 11333087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).