C11H18F3NO3 — CID 113331103
methyl 2-[4-(4,4,4-trifluorobutyl)morpholin-2-yl]acetate (PubChem CID 113331103) has the molecular formula C11H18F3NO3 and a molecular weight of 269.26 g/mol. Its IUPAC name is methyl 2-[4-(4,4,4-trifluorobutyl)morpholin-2-yl]acetate.
| Compound Name | methyl 2-[4-(4,4,4-trifluorobutyl)morpholin-2-yl]acetate |
|---|---|
| PubChem CID | 113331103 |
| Molecular Formula | C11H18F3NO3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | methyl 2-[4-(4,4,4-trifluorobutyl)morpholin-2-yl]acetate |
| SMILES | COC(=O)CC1CN(CCCC(F)(F)F)CCO1 |
| InChI | InChI=1S/C11H18F3NO3/c1-17-10(16)7-9-8-15(5-6-18-9)4-2-3-11(12,13)14/h9H,2-8H2,1H3 |
| InChIKey | UQVDOLTVCRWDDI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |