About methyl (2R)-2-fluorodecanoate
methyl (2R)-2-fluorodecanoate (PubChem CID 11333185) has the molecular formula C11H21FO2
and a molecular weight of 204.28 g/mol. Its IUPAC name is methyl (2R)-2-fluorodecanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-fluorodecanoate |
| PubChem CID | 11333185 |
| Molecular Formula | C11H21FO2 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | methyl (2R)-2-fluorodecanoate |
| SMILES | CCCCCCCC[C@@H](F)C(=O)OC |
| InChI | InChI=1S/C11H21FO2/c1-3-4-5-6-7-8-9-10(12)11(13)14-2/h10H,3-9H2,1-2H3/t10-/m1/s1 |
| InChIKey | SPCPRQJNPITCCB-SNVBAGLBSA-N |
| XLogP | 3.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R)-2-fluorodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-fluorodecanoate?
The IUPAC name of methyl (2R)-2-fluorodecanoate (CID 11333185) is methyl (2R)-2-fluorodecanoate.
What is the SMILES notation for methyl (2R)-2-fluorodecanoate?
The canonical SMILES for methyl (2R)-2-fluorodecanoate is CCCCCCCC[C@@H](F)C(=O)OC.
What is the InChIKey of methyl (2R)-2-fluorodecanoate?
The InChIKey is SPCPRQJNPITCCB-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H21FO2/c1-3-4-5-6-7-8-9-10(12)11(13)14-2/h10H,3-9H2,1-2H3/t10-/m1/s1.
What are the key properties of methyl (2R)-2-fluorodecanoate?
methyl (2R)-2-fluorodecanoate has a molecular weight of 204.28 g/mol, XLogP of 3.25, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-fluorodecanoate is sourced from PubChem (CID 11333185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).