C12H13N3O4 — CID 113331892
1-[2-(ethylamino)-2-oxoethyl]-2-oxo-3H-benzimidazole-4-carboxylic acid (PubChem CID 113331892) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is 1-[2-(ethylamino)-2-oxoethyl]-2-oxo-3H-benzimidazole-4-carboxylic acid.
| Compound Name | 1-[2-(ethylamino)-2-oxoethyl]-2-oxo-3H-benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 113331892 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 1-[2-(ethylamino)-2-oxoethyl]-2-oxo-3H-benzimidazole-4-carboxylic acid |
| SMILES | CCNC(=O)Cn1c(=O)[nH]c2c(C(=O)O)cccc21 |
| InChI | InChI=1S/C12H13N3O4/c1-2-13-9(16)6-15-8-5-3-4-7(11(17)18)10(8)14-12(15)19/h3-5H,2,6H2,1H3,(H,13,16)(H,14,19)(H,17,18) |
| InChIKey | CMESHGYLXDDJOY-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |