C12H15NO2 — CID 11333200
(3S)-1-oxido-3-phenylmethoxy-2,3,4,5-tetrahydropyridin-1-ium (PubChem CID 11333200) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (3S)-1-oxido-3-phenylmethoxy-2,3,4,5-tetrahydropyridin-1-ium.
| Compound Name | (3S)-1-oxido-3-phenylmethoxy-2,3,4,5-tetrahydropyridin-1-ium |
|---|---|
| PubChem CID | 11333200 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (3S)-1-oxido-3-phenylmethoxy-2,3,4,5-tetrahydropyridin-1-ium |
| SMILES | [O-][N+]1=CCC[C@H](OCc2ccccc2)C1 |
| InChI | InChI=1S/C12H15NO2/c14-13-8-4-7-12(9-13)15-10-11-5-2-1-3-6-11/h1-3,5-6,8,12H,4,7,9-10H2/t12-/m0/s1 |
| InChIKey | PGNXOJSCITVCPJ-LBPRGKRZSA-N |
| XLogP | 1.95 |
| TPSA | 35.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|