About 3-(2-oxopropyl)-1,3-benzothiazol-2-one
3-(2-oxopropyl)-1,3-benzothiazol-2-one (PubChem CID 11333239) has the molecular formula C10H9NO2S
and a molecular weight of 207.25 g/mol. Its IUPAC name is 3-(2-oxopropyl)-1,3-benzothiazol-2-one.
Molecular Properties
| Compound Name | 3-(2-oxopropyl)-1,3-benzothiazol-2-one |
| PubChem CID | 11333239 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 3-(2-oxopropyl)-1,3-benzothiazol-2-one |
| SMILES | CC(=O)Cn1c(=O)sc2ccccc21 |
| InChI | InChI=1S/C10H9NO2S/c1-7(12)6-11-8-4-2-3-5-9(8)14-10(11)13/h2-5H,6H2,1H3 |
| InChIKey | KFEHNUWBLIZIOR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-oxopropyl)-1,3-benzothiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-oxopropyl)-1,3-benzothiazol-2-one?
The IUPAC name of 3-(2-oxopropyl)-1,3-benzothiazol-2-one (CID 11333239) is 3-(2-oxopropyl)-1,3-benzothiazol-2-one.
What is the SMILES notation for 3-(2-oxopropyl)-1,3-benzothiazol-2-one?
The canonical SMILES for 3-(2-oxopropyl)-1,3-benzothiazol-2-one is CC(=O)Cn1c(=O)sc2ccccc21.
What is the InChIKey of 3-(2-oxopropyl)-1,3-benzothiazol-2-one?
The InChIKey is KFEHNUWBLIZIOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2S/c1-7(12)6-11-8-4-2-3-5-9(8)14-10(11)13/h2-5H,6H2,1H3.
What are the key properties of 3-(2-oxopropyl)-1,3-benzothiazol-2-one?
3-(2-oxopropyl)-1,3-benzothiazol-2-one has a molecular weight of 207.25 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-oxopropyl)-1,3-benzothiazol-2-one is sourced from PubChem (CID 11333239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).