C9H14F2O3 — CID 11333249
(1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluorobut-3-en-1-ol (PubChem CID 11333249) has the molecular formula C9H14F2O3 and a molecular weight of 208.20 g/mol. Its IUPAC name is (1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluorobut-3-en-1-ol.
| Compound Name | (1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluorobut-3-en-1-ol |
|---|---|
| PubChem CID | 11333249 |
| Molecular Formula | C9H14F2O3 |
| Molecular Weight | 208.20 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | (1R)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-difluorobut-3-en-1-ol |
| SMILES | C=CC(F)(F)[C@H](O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C9H14F2O3/c1-4-9(10,11)7(12)6-5-13-8(2,3)14-6/h4,6-7,12H,1,5H2,2-3H3/t6-,7-/m1/s1 |
| InChIKey | NTJMUNNQVVUTJS-RNFRBKRXSA-N |
| XLogP | 1.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.20 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|