C14H16O2 — CID 11333403
(1R,3S,6R,7R)-9-acetyl-3,6-dimethyltricyclo[4.3.1.03,7]deca-4,8-dien-2-one (PubChem CID 11333403) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (1R,3S,6R,7R)-9-acetyl-3,6-dimethyltricyclo[4.3.1.03,7]deca-4,8-dien-2-one.
| Compound Name | (1R,3S,6R,7R)-9-acetyl-3,6-dimethyltricyclo[4.3.1.03,7]deca-4,8-dien-2-one |
|---|---|
| PubChem CID | 11333403 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (1R,3S,6R,7R)-9-acetyl-3,6-dimethyltricyclo[4.3.1.03,7]deca-4,8-dien-2-one |
| SMILES | CC(=O)C1=C[C@@H]2[C@@]3(C)C=C[C@]2(C)C(=O)[C@@H]1C3 |
| InChI | InChI=1S/C14H16O2/c1-8(15)9-6-11-13(2)4-5-14(11,3)12(16)10(9)7-13/h4-6,10-11H,7H2,1-3H3/t10-,11-,13+,14+/m1/s1 |
| InChIKey | WIYXRSRHOKMPFX-RFHZTLPTSA-N |
| XLogP | 2.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|