C14H21ClN2 — CID 113334150
2-chloro-5-methyl-4-N-(4-methylcyclohexyl)benzene-1,4-diamine (PubChem CID 113334150) has the molecular formula C14H21ClN2 and a molecular weight of 252.79 g/mol. Its IUPAC name is 2-chloro-5-methyl-4-N-(4-methylcyclohexyl)benzene-1,4-diamine.
| Compound Name | 2-chloro-5-methyl-4-N-(4-methylcyclohexyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 113334150 |
| Molecular Formula | C14H21ClN2 |
| Molecular Weight | 252.79 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-chloro-5-methyl-4-N-(4-methylcyclohexyl)benzene-1,4-diamine |
| SMILES | Cc1cc(N)c(Cl)cc1NC1CCC(C)CC1 |
| InChI | InChI=1S/C14H21ClN2/c1-9-3-5-11(6-4-9)17-14-8-12(15)13(16)7-10(14)2/h7-9,11,17H,3-6,16H2,1-2H3 |
| InChIKey | BHYNZKOMWCSDIH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.79 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|