C12H16ClF3N2 — CID 113334280
2-chloro-5-methyl-4-N-propyl-4-N-(2,2,2-trifluoroethyl)benzene-1,4-diamine (PubChem CID 113334280) has the molecular formula C12H16ClF3N2 and a molecular weight of 280.72 g/mol. Its IUPAC name is 2-chloro-5-methyl-4-N-propyl-4-N-(2,2,2-trifluoroethyl)benzene-1,4-diamine.
| Compound Name | 2-chloro-5-methyl-4-N-propyl-4-N-(2,2,2-trifluoroethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 113334280 |
| Molecular Formula | C12H16ClF3N2 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-chloro-5-methyl-4-N-propyl-4-N-(2,2,2-trifluoroethyl)benzene-1,4-diamine |
| SMILES | CCCN(CC(F)(F)F)c1cc(Cl)c(N)cc1C |
| InChI | InChI=1S/C12H16ClF3N2/c1-3-4-18(7-12(14,15)16)11-6-9(13)10(17)5-8(11)2/h5-6H,3-4,7,17H2,1-2H3 |
| InChIKey | SIVQUQWPWZGNFE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|