About 2-chloro-4-N,5-dimethyl-4-N-(3-methylphenyl)benzene-1,4-diamine
2-chloro-4-N,5-dimethyl-4-N-(3-methylphenyl)benzene-1,4-diamine (PubChem CID 113334304) has the molecular formula C15H17ClN2
and a molecular weight of 260.77 g/mol. Its IUPAC name is 2-chloro-4-N,5-dimethyl-4-N-(3-methylphenyl)benzene-1,4-diamine.
Molecular Properties
| Compound Name | 2-chloro-4-N,5-dimethyl-4-N-(3-methylphenyl)benzene-1,4-diamine |
| PubChem CID | 113334304 |
| Molecular Formula | C15H17ClN2 |
| Molecular Weight | 260.77 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-chloro-4-N,5-dimethyl-4-N-(3-methylphenyl)benzene-1,4-diamine |
| SMILES | Cc1cccc(N(C)c2cc(Cl)c(N)cc2C)c1 |
| InChI | InChI=1S/C15H17ClN2/c1-10-5-4-6-12(7-10)18(3)15-9-13(16)14(17)8-11(15)2/h4-9H,17H2,1-3H3 |
| InChIKey | MKTLYWRMLMGAAL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.77 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-N,5-dimethyl-4-N-(3-methylphenyl)benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-N,5-dimethyl-4-N-(3-methylphenyl)benzene-1,4-diamine?
The IUPAC name of 2-chloro-4-N,5-dimethyl-4-N-(3-methylphenyl)benzene-1,4-diamine (CID 113334304) is 2-chloro-4-N,5-dimethyl-4-N-(3-methylphenyl)benzene-1,4-diamine.
What is the SMILES notation for 2-chloro-4-N,5-dimethyl-4-N-(3-methylphenyl)benzene-1,4-diamine?
The canonical SMILES for 2-chloro-4-N,5-dimethyl-4-N-(3-methylphenyl)benzene-1,4-diamine is Cc1cccc(N(C)c2cc(Cl)c(N)cc2C)c1.
What is the InChIKey of 2-chloro-4-N,5-dimethyl-4-N-(3-methylphenyl)benzene-1,4-diamine?
The InChIKey is MKTLYWRMLMGAAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17ClN2/c1-10-5-4-6-12(7-10)18(3)15-9-13(16)14(17)8-11(15)2/h4-9H,17H2,1-3H3.
What are the key properties of 2-chloro-4-N,5-dimethyl-4-N-(3-methylphenyl)benzene-1,4-diamine?
2-chloro-4-N,5-dimethyl-4-N-(3-methylphenyl)benzene-1,4-diamine has a molecular weight of 260.77 g/mol, XLogP of 4.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-N,5-dimethyl-4-N-(3-methylphenyl)benzene-1,4-diamine is sourced from PubChem (CID 113334304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).