C11H10ClN3O2S — CID 113334569
5-chloro-2-methyl-4-nitro-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 113334569) has the molecular formula C11H10ClN3O2S and a molecular weight of 283.74 g/mol. Its IUPAC name is 5-chloro-2-methyl-4-nitro-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 5-chloro-2-methyl-4-nitro-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 113334569 |
| Molecular Formula | C11H10ClN3O2S |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 5-chloro-2-methyl-4-nitro-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | Cc1cc([N+](=O)[O-])c(Cl)cc1NCc1cscn1 |
| InChI | InChI=1S/C11H10ClN3O2S/c1-7-2-11(15(16)17)9(12)3-10(7)13-4-8-5-18-6-14-8/h2-3,5-6,13H,4H2,1H3 |
| InChIKey | RFYQNZRVTAOBHU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|