C14H22O2 — CID 11333540
7-[(1E)-1-ethoxybuta-1,3-dienyl]-4-ethyl-2,3,4,5-tetrahydrooxepine (PubChem CID 11333540) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 7-[(1E)-1-ethoxybuta-1,3-dienyl]-4-ethyl-2,3,4,5-tetrahydrooxepine.
| Compound Name | 7-[(1E)-1-ethoxybuta-1,3-dienyl]-4-ethyl-2,3,4,5-tetrahydrooxepine |
|---|---|
| PubChem CID | 11333540 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 7-[(1E)-1-ethoxybuta-1,3-dienyl]-4-ethyl-2,3,4,5-tetrahydrooxepine |
| SMILES | C=C/C=C(/OCC)C1=CCC(CC)CCO1 |
| InChI | InChI=1S/C14H22O2/c1-4-7-13(15-6-3)14-9-8-12(5-2)10-11-16-14/h4,7,9,12H,1,5-6,8,10-11H2,2-3H3/b13-7+ |
| InChIKey | QFMOZSZHYYSPTF-NTUHNPAUSA-N |
| XLogP | 3.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|