About N'-(2,2,2-trichloroethanimidoyl)cyclopropanecarboximidamide
N'-(2,2,2-trichloroethanimidoyl)cyclopropanecarboximidamide (PubChem CID 11333665) has the molecular formula C6H8Cl3N3
and a molecular weight of 228.51 g/mol. Its IUPAC name is N'-(2,2,2-trichloroethanimidoyl)cyclopropanecarboximidamide.
Molecular Properties
| Compound Name | N'-(2,2,2-trichloroethanimidoyl)cyclopropanecarboximidamide |
| PubChem CID | 11333665 |
| Molecular Formula | C6H8Cl3N3 |
| Molecular Weight | 228.51 g/mol |
| Exact Mass | 226.98 |
| IUPAC Name | N'-(2,2,2-trichloroethanimidoyl)cyclopropanecarboximidamide |
| SMILES | [H]/N=C(/N=C(\N)C1CC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H8Cl3N3/c7-6(8,9)5(11)12-4(10)3-1-2-3/h3H,1-2H2,(H3,10,11,12) |
| InChIKey | FIPLWXWZWFSGJR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,2,2-trichloroethanimidoyl)cyclopropanecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,2,2-trichloroethanimidoyl)cyclopropanecarboximidamide?
The IUPAC name of N'-(2,2,2-trichloroethanimidoyl)cyclopropanecarboximidamide (CID 11333665) is N'-(2,2,2-trichloroethanimidoyl)cyclopropanecarboximidamide.
What is the SMILES notation for N'-(2,2,2-trichloroethanimidoyl)cyclopropanecarboximidamide?
The canonical SMILES for N'-(2,2,2-trichloroethanimidoyl)cyclopropanecarboximidamide is [H]/N=C(/N=C(\N)C1CC1)C(Cl)(Cl)Cl.
What is the InChIKey of N'-(2,2,2-trichloroethanimidoyl)cyclopropanecarboximidamide?
The InChIKey is FIPLWXWZWFSGJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8Cl3N3/c7-6(8,9)5(11)12-4(10)3-1-2-3/h3H,1-2H2,(H3,10,11,12).
What are the key properties of N'-(2,2,2-trichloroethanimidoyl)cyclopropanecarboximidamide?
N'-(2,2,2-trichloroethanimidoyl)cyclopropanecarboximidamide has a molecular weight of 228.51 g/mol, XLogP of 2.10, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,2,2-trichloroethanimidoyl)cyclopropanecarboximidamide is sourced from PubChem (CID 11333665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).