tert-butyl 5-methylindole-1-carboxylate

C14H17NO2 — CID 11333711

IUPACtert-butyl 5-methylindole-1-carboxylate
SMILESCc1ccc2c(ccn2C(=O)OC(C)(C)C)c1
InChIInChI=1S/C14H17NO2/c1-10-5-6-12-11(9-10)7-8-15(12)13(16)17-14(2,3)4/h5-9H,1-4H3
InChIKeyNSPCCUXHOQOAJQ-UHFFFAOYSA-N
MW231.30 g/mol
LogP3.73
Rot. Bonds

About tert-butyl 5-methylindole-1-carboxylate

tert-butyl 5-methylindole-1-carboxylate (PubChem CID 11333711) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is tert-butyl 5-methylindole-1-carboxylate.

Molecular Properties

Compound Nametert-butyl 5-methylindole-1-carboxylate
PubChem CID11333711
Molecular FormulaC14H17NO2
Molecular Weight231.30 g/mol
Exact Mass231.13
IUPAC Nametert-butyl 5-methylindole-1-carboxylate
SMILESCc1ccc2c(ccn2C(=O)OC(C)(C)C)c1
InChIInChI=1S/C14H17NO2/c1-10-5-6-12-11(9-10)7-8-15(12)13(16)17-14(2,3)4/h5-9H,1-4H3
InChIKeyNSPCCUXHOQOAJQ-UHFFFAOYSA-N
XLogP3.73
TPSA31.23 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.30
LogP ≤ 53.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze tert-butyl 5-methylindole-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl 5-methylindole-1-carboxylate?
The IUPAC name of tert-butyl 5-methylindole-1-carboxylate (CID 11333711) is tert-butyl 5-methylindole-1-carboxylate.
What is the SMILES notation for tert-butyl 5-methylindole-1-carboxylate?
The canonical SMILES for tert-butyl 5-methylindole-1-carboxylate is Cc1ccc2c(ccn2C(=O)OC(C)(C)C)c1.
What is the InChIKey of tert-butyl 5-methylindole-1-carboxylate?
The InChIKey is NSPCCUXHOQOAJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO2/c1-10-5-6-12-11(9-10)7-8-15(12)13(16)17-14(2,3)4/h5-9H,1-4H3.
What are the key properties of tert-butyl 5-methylindole-1-carboxylate?
tert-butyl 5-methylindole-1-carboxylate has a molecular weight of 231.30 g/mol, XLogP of 3.73, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5-methylindole-1-carboxylate is sourced from PubChem (CID 11333711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).