C13H15BrClN3 — CID 113337190
N-[(3-bromo-4-chlorophenyl)-(1-methylpyrazol-4-yl)methyl]ethanamine (PubChem CID 113337190) has the molecular formula C13H15BrClN3 and a molecular weight of 328.64 g/mol. Its IUPAC name is N-[(3-bromo-4-chlorophenyl)-(1-methylpyrazol-4-yl)methyl]ethanamine.
| Compound Name | N-[(3-bromo-4-chlorophenyl)-(1-methylpyrazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 113337190 |
| Molecular Formula | C13H15BrClN3 |
| Molecular Weight | 328.64 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | N-[(3-bromo-4-chlorophenyl)-(1-methylpyrazol-4-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(Cl)c(Br)c1)c1cnn(C)c1 |
| InChI | InChI=1S/C13H15BrClN3/c1-3-16-13(10-7-17-18(2)8-10)9-4-5-12(15)11(14)6-9/h4-8,13,16H,3H2,1-2H3 |
| InChIKey | FBZCTXCONFTNQL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.64 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |